Chemical plants supply high-quality 3-(Trichlorovinyl)anilinium chloride 81972-27-2 in bulk

Q: What is the 3-(Trichlorovinyl)anilinium chloride?

3-(Trichlorovinyl)anilinium chloride is , while it's Molecular Formula is C 8 H 6 Cl 3 N*ClH. Used in Synthetic Chemistry: 3-(Trichlorovinyl)anilinium chloride is used as a synthetic intermediate for the production of various chemical compounds and materials. Its unique structure allows it to participate in a range of chemical reactions, facilitating the synthesis of complex organic molecules and contributing to the development of new pharmaceuticals, agrochemicals, and specialty chemicals. Used in Pharmaceutical Industry: In the pharmaceutical industry, 3-(Trichlorovinyl)anilinium chloride is used as a building block for the synthesis of active pharmaceutical ingredients. Its reactivity and functional groups make it a valuable component in the creation of new drugs with specific therapeutic properties, potentially leading to advancements in the treatment of various diseases and medical conditions. Used in Agrochemical Industry: 3-(Trichlorovinyl)anilinium chloride is utilized as a key component in the development of agrochemicals, such as pesticides and herbicides. Its chemical properties enable it to be incorporated into formulations that effectively control, prevent, or kill unwanted organisms in agricultural settings, thereby contributing to increased crop yields and protection against pests. Used in Specialty Chemicals Production: 3-(Trichlorovinyl)anilinium chloride is employed as a precursor in the production of specialty chemicals, which are high-value compounds used in niche applications. These may include dyes, pigments, polymers, and other materials that require specific chemical and physical properties, such as resistance to heat, light, or chemicals, making them suitable for use in various industries like textiles, plastics, and coatings.

Chemical plants supply high-quality 3-(Trichlorovinyl)anilinium chloride 81972-27-2 in bulk We provide high quality 3-(Trichlorovinyl)anilinium chloride (CAS 81972-27-2), at a very affordable prices to our customers.

1.What is the 3-(Trichlorovinyl)anilinium chloride ?

3-(Trichlorovinyl)anilinium chloride is an organic chemical compound characterized by its unique arrangement of atoms, including carbon, nitrogen, hydrogen, and chlorine. It features trichlorovinyl and anilinium groupings, and while the exact structural details and properties like molar mass may differ based on the synthesis methods, 3-(Trichlorovinyl)anilinium chloride is recognized for its potential applications in various scientific and industrial fields, particularly in synthetic chemistry.

Used in Synthetic Chemistry:
3-(Trichlorovinyl)anilinium chloride is used as a synthetic intermediate for the production of various chemical compounds and materials. Its unique structure allows it to participate in a range of chemical reactions, facilitating the synthesis of complex organic molecules and contributing to the development of new pharmaceuticals, agrochemicals, and specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-(Trichlorovinyl)anilinium chloride is used as a building block for the synthesis of active pharmaceutical ingredients. Its reactivity and functional groups make it a valuable component in the creation of new drugs with specific therapeutic properties, potentially leading to advancements in the treatment of various diseases and medical conditions.
Used in Agrochemical Industry:
3-(Trichlorovinyl)anilinium chloride is utilized as a key component in the development of agrochemicals, such as pesticides and herbicides. Its chemical properties enable it to be incorporated into formulations that effectively control, prevent, or kill unwanted organisms in agricultural settings, thereby contributing to increased crop yields and protection against pests.
Used in Specialty Chemicals Production:
3-(Trichlorovinyl)anilinium chloride is employed as a precursor in the production of specialty chemicals, which are high-value compounds used in niche applications. These may include dyes, pigments, polymers, and other materials that require specific chemical and physical properties, such as resistance to heat, light, or chemicals, making them suitable for use in various industries like textiles, plastics, and coatings.

2.What is the CAS number for 3-(Trichlorovinyl)anilinium chloride ?

The CAS number of 3-(Trichlorovinyl)anilinium chloride is 81972-27-2.

More information of 3-(Trichlorovinyl)anilinium chloride 81972-27-2 are:

CAS?Number	81972-27-2
Boiling Point	319.9 °C at 760 mmHg
Flash Point	147.3 °C
Vapor Pressure	0.000328mmHg at 25°C
PSA	27.64000
LogP	-0.09350

3.What is the molecular formula of 3-(Trichlorovinyl)anilinium chloride ?

The chemical formula of?3-(Trichlorovinyl)anilinium chloride is C₈H₆Cl₃N*ClH which containing 8 Carbon atoms,7 Hydrogen atoms and 4 Chlorine atoms,and the molecular weight, and the molecular weight of 3-(Trichlorovinyl)anilinium chloride is 258.962

4.What is 3-(Trichlorovinyl)anilinium chloride(81972-27-2)used for?

3-(Trichlorovinyl)anilinium chloride is an organic chemical compound characterized by its unique arrangement of atoms, including carbon, nitrogen, hydrogen, and chlorine. It features trichlorovinyl and anilinium groupings, and while the exact structural details and properties like molar mass may differ based on the synthesis methods, 3-(Trichlorovinyl)anilinium chloride is recognized for its potential applications in various scientific and industrial fields, particularly in synthetic chemistry.

InChI:InChI=1/C8H6Cl3N.ClH/c9-7(8(10)11)5-2-1-3-6(12)4-5;/h1-4H,12H2;1H

Relevant articles related to 3-(Trichlorovinyl)anilinium chloride:

Article

Source

Hydrogenation of 3-trichlorovinylnitrobenzene

-

, (2008/06/13)

5.Chemical plants supply high-quality 3-(Trichlorovinyl)anilinium chloride 81972-27-2 in bulk

ShanDong XinDa Chemical CO.,LTD is a quality supplier of 3-(Trichlorovinyl)anilinium chloride. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 3-(Trichlorovinyl)anilinium chloride 81972-27-2.